| CAS: 840-97-1 Product: Ethyl N-acetyl-L-tyrosinate No suppliers available. |
| Classification | Biochemical >> Amino acids and their derivatives >> Tyrosine derivatives |
|---|---|
| Name | Ethyl N-acetyl-L-tyrosinate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 |
| Protein Sequence | Y |
| CAS Registry Number | 840-97-1 |
| EC Number | 212-663-5 |
| SMILES | CCOC(=O)[C@H](CC1=CC=C(C=C1)O)NC(=O)C |
| Solubility | 4812 mg/L (25 °C water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.534, Calc.* |
| Melting point | 172.78 °C |
| Boiling Point | 464.4±35.0 °C (760 mmHg), Calc.*, 417.97 °C |
| Flash Point | 234.6±25.9 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H319 Details |
| Safety Statements | P264-P270-P280-P301+P312-P305+P351+P338-P330-P337+P313-P501 Details |
| SDS | Available |
| Market Analysis Reports |