Online Database of Chemicals from Around the World

5-Methoxytryptamine hydrochloride
[CAS 66-83-1]

List of Suppliers
Chizhou Dongsheng Pharmaceutical Co., Ltd. China
www.dspharmchem.com
+86 (576) 8429-2571
+86 (576) 8429-2560
ksz@dspharmchem.com
Chemical manufacturer since 1995
chemBlink Premium supplier since 2011
Identification
ClassificationAPI >> Other chemicals
Name5-Methoxytryptamine hydrochloride
Synonyms3-(2-Aminoethyl)-5-methoxyindole hydrochloride
Molecular Structure5-Methoxytryptamine hydrochloride molecular structure (CAS 66-83-1)
Molecular FormulaC11H14N2O.HCl
Molecular Weight226.70
CAS Registry Number66-83-1
EC Number200-637-6
SMILESCOC1=CC2=C(C=C1)NC=C2CCN.Cl
Properties
Melting point246-248 °C
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH302  Details
Safety StatementsP264-P270-P301+P317-P330-P501  Details
Hazard Classification
up    Details
HazardClassCategory CodeHazard Statement
Acute toxicityAcute Tox.4H302
SDSAvailable
up chemBlink Chemical Story
5-Methoxytryptamine hydrochloride is a chemical compound that has gained attention in both synthetic chemistry and pharmacology due to its unique properties and potential applications. This compound, a derivative of tryptamine, plays a significant role in the study of neurotransmitters and has potential therapeutic applications.

The discovery of 5-Methoxytryptamine hydrochloride is rooted in the broader investigation of tryptamine derivatives. Tryptamine itself is a naturally occurring compound that is a precursor to various biologically active substances, including serotonin and melatonin. The addition of a methoxy group to the 5-position of the tryptamine structure yields 5-Methoxytryptamine, which is further stabilized and utilized in its hydrochloride form. This derivative was identified through the exploration of substituted tryptamines and their biological activities, providing insights into their roles as neurotransmitters and their potential effects on human physiology.

5-Methoxytryptamine hydrochloride is primarily used in research focused on neurotransmitter systems. It is known to interact with serotonin receptors, particularly the 5-HT2A receptor subtype. This interaction is of significant interest because it helps in understanding the mechanisms underlying various neuropsychiatric conditions. Researchers use 5-Methoxytryptamine hydrochloride to investigate the structure-activity relationships of serotonin receptor ligands, which can lead to the development of new therapeutic agents for disorders such as depression, anxiety, and schizophrenia.

The compound is also employed in studies related to the synthesis of new psychoactive substances. By modifying the tryptamine scaffold, chemists can explore a range of compounds with altered pharmacological profiles. 5-Methoxytryptamine hydrochloride serves as a valuable intermediate in these syntheses, providing a basis for creating derivatives with enhanced or modified effects.

In addition to its use in neuroscience research, 5-Methoxytryptamine hydrochloride has potential applications in pharmacological studies aimed at understanding the effects of serotonin receptor modulation. Its ability to act as a selective ligand for specific serotonin receptor subtypes makes it a useful tool in developing and testing new drugs targeting these receptors. This can lead to advancements in treatments for mood disorders and other conditions related to serotonin dysregulation.

The synthesis of 5-Methoxytryptamine hydrochloride typically involves the methylation of tryptamine at the 5-position using methoxy reagents, followed by the formation of the hydrochloride salt to enhance stability and solubility. Characterization of the compound is performed using techniques such as nuclear magnetic resonance (NMR) spectroscopy, mass spectrometry, and high-performance liquid chromatography (HPLC) to ensure its purity and confirm its chemical structure.

In summary, 5-Methoxytryptamine hydrochloride is a valuable compound in the fields of chemical research and pharmacology. Its role in studying neurotransmitter systems and its potential applications in drug development highlight its importance in advancing our understanding of neurochemical processes and therapeutic interventions.

References

2006. Solvent effects in the preparation of molecularly imprinted polymers for melatonin using N-propionyl-5-methoxytryptamine as the pseudo template. Analytical and Bioanalytical Chemistry, 384(4).
DOI: 10.1007/s00216-006-0310-z

1973. Indole derivatives. Chemistry of Heterocyclic Compounds, 9(11).
DOI: 10.1007/bf00470342

1969. Color reactions for dimecarbin and mexamine. Pharmaceutical Chemistry Journal, 3(6).
DOI: 10.1007/bf00764141
Market Analysis Reports
Related Products
4-Methoxytrityl...  Fmoc-S-(4-Metho...  (3S)-1-{2-[(4-M...  Methoxy(Triviny...  6b-Methoxy-3-Tr...  3-Methoxytropol...  5-Methoxy-8-Trp...  4-Methoxytrypta...  6-Methoxytrypta...  5-Methoxytrypta...  6-Methoxytrypta...  5-Methoxytrypto...  5-Methoxy-dl-tr...  7-Methoxytrypto...  5-Methoxytrypto...  2-Methoxytyrami...  3-Methoxy-L-tyr...  4-Methoxytyrosi...  3-Methoxy-L-tyr...  11-Methoxyuncar...