| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Florida Center for Heterocyclic Compounds | USA | |||
|---|---|---|---|---|
![]() |
+1 (352) 392-0554 | |||
![]() |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Tyger Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (609) 434-0144 | |||
![]() |
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| Name | 1,3,5-Cyclohexanetricarboxylic Acid |
|---|---|
| Synonyms | Nsc409575; 1,3,5-Cyclohexanetricarboxylic Acid; 344346_Aldrich |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12O6 |
| Molecular Weight | 216.19 |
| CAS Registry Number | 25357-95-3 |
| SMILES | O=C(C1CC(CC(C1)C(O)=O)C(O)=O)O |
| InChI | 1S/C9H12O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h4-6H,1-3H2,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | FTHDNRBKSLBLDA-UHFFFAOYSA-N |
| Density | 1.51g/cm3 (Cal.) |
|---|---|
| Melting point | 218°C (Expl.) |
| Boiling point | 372.398°C at 760 mmHg (Cal.) |
| Flash point | 193.2°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Zhi Su, You Song, Zheng-Shuai Bai, Jian Fan, Guang-Xiang Liu and Wei-Yin Sun. Unprecedented three-dimensional 10-connected bct nets based on trinuclear secondary building units and their magnetic behavior, CrystEngComm, 2010, 12, 4339. |
|---|---|
| Market Analysis Reports |