Online Database of Chemicals from Around the World

Bis-(3-indenyl)methane
[CAS 201297-79-2]

List of Suppliers
Zhengzhou Kingorgchem Chemical Technology Co., Ltd. China
www.kingorgchem.com
+86 (371) 6551-1006
+86 (371) 6575-6965
sales@kingorgchem.com
QQ Chat
WeChat: 18625597674
Chemical manufacturer since 2015
chemBlink Standard supplier since 2016

Identification
NameBis-(3-indenyl)methane
SynonymsDi(1H-inden-3-yl)methane;
Molecular StructureBis-(3-indenyl)methane molecular structure (CAS 201297-79-2)
Molecular FormulaC19H16
Molecular Weight244.33
CAS Registry Number201297-79-2
SMILESC1C=C(C2=CC=CC=C21)CC3=CCC4=CC=CC=C43
Properties
Density1.1±0.1 g/cm3, Calc.*
Index of Refraction1.660, Calc.*
Boiling Point394.5±37.0 °C (760 mmHg), Calc.*
Flash Point211.2±17.2 °C, Calc.*
*Calculated using Advanced Chemistry Development (ACD/Labs) Software.
up chemBlink Chemical Story
Bis-(3-indenyl)methane is an intriguing organometallic compound characterized by its unique structure and versatile applications in chemistry. Comprising two 3-indenyl groups attached to a central methane unit, this compound stands out due to its distinctive electronic and steric properties, which have made it a subject of interest in various fields of research.

The discovery of bis-(3-indenyl)methane arose from the exploration of new organometallic frameworks with potential for enhancing catalytic and material properties. The 3-indenyl groups are known for their aromatic stability and ability to stabilize metal centers through π-donation. When attached to a central methane group, these units create a compound with enhanced stability and unique electronic characteristics.

In terms of applications, bis-(3-indenyl)methane is particularly valuable in the field of organometallic chemistry and catalysis. The compound's structure allows it to function effectively as a ligand in transition metal complexes, providing stability and influencing the reactivity of the metal center. Such complexes are crucial in a variety of catalytic processes, including polymerization and organic synthesis.

One notable application of bis-(3-indenyl)methane is in the synthesis of metal complexes for olefin polymerization. The compound's ability to stabilize metal centers and facilitate interactions with olefins makes it a valuable component in designing catalysts for producing high-performance polymers. Additionally, the unique electronic properties imparted by the 3-indenyl groups contribute to the development of advanced materials with specific desired characteristics.

Another area where bis-(3-indenyl)methane shows promise is in the development of novel materials with enhanced electronic or optical properties. The compound's structure allows for the tuning of these properties, making it useful in applications ranging from electronic devices to photonic materials.

In summary, bis-(3-indenyl)methane represents a significant advancement in organometallic chemistry. Its distinctive structure and electronic properties offer valuable opportunities for enhancing catalytic processes and developing advanced materials. The compound continues to be an area of active research, contributing to various applications in both industrial and academic settings.

References

2012. Two-Step Synthesis of Stable Dioxadicarbaporphyrins from Bis(3-indenyl)methane. Angewandte Chemie International Edition, 51(40). DOI: 10.1002/anie.201206385

2012. Nitrogen-Free [18]Porphyrinoids in Two Steps. Synfacts. DOI: 10.1055/s-0032-1317882
Market Analysis Reports
Related Products
Bis(Imidazole)(...  1,2-BIS-(IMIDAZ...  Bis(2-Imidazoly...  1,4-Bis((1H-imi...  4,4'-Bis(alpha-...  Bis[Imino(1-Pyr...  2,6-Bis[(3aR,8a...  Bis(indenyl)dim...  1,2-Bis(3-inden...  Bis[(1,2,3,3a,7...  8,8-Bis(1H-indo...  2-[2,2-Bis-(1H-...  Bisindolylmalei...  Bisindolylmalei...  Bisindolylmalei...  Bisindolylmalei...  Bisindolylmalei...  Bisindolylmalei...  Bisindolylmalei...  Bisindolylmalei...